Ospemifene D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-14272 |
| Alternative Name(s) | 2-{4-[(1Z)-4-chloro-1,2-diphenylbut-1-en-1- yl]phenoxy}(D4)ethan-1-ol |
| Research Area | Labeled Ospemifene , intended for use as an internal standard for the quantification of Ospemifene by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H19D4ClO2 |
| CAS# | 128607-22-7 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClCC/C(C1=CC=CC=C1)=C(C2=CC=CC=C2)/C3=CC=C(OC([2H])([2H])C([2H])([2H])O)C=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14272.html |
| Additional Information | NULL |