Exemestane D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16368 |
| Alternative Name(s) | (8R,9S,10R,13S,14S)-10,13-dimethyl-6-methylene-7,8,9,10,11,12,13,14,15,16-decahydro-3H-cyclopenta[a]phenanthrene-3,17(6H)-dione D4; (1S,2R,10R,11S,15S)-2,15-dimethyl-8-(D2)methylidene(13,13-D2)tetracyclo[8.7.0.02,7.011,15]heptadeca-3,6-diene-5,14-dione |
| Research Area | Labeled Exemestane, intended for use as an internal standard for the quantification of Exemestane by GC- or LC-mass spectrometry. |
| Molecular Formula | C20H20D4O2 |
| CAS# | 107868-30-4 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@](C(/C1=C([2H])[2H])=CC2=O)(C=C2)[C@]3([H])[C@](C1)([H])[C@@](CC([2H])([2H])C4=O)([H])[C@]4(C)CC3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16368.html |
| Additional Information | NULL |