Citalopram D4 Oxalate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-15116 |
| Alternative Name(s) | 1‐[3‐(dimethylamino)propyl]‐1‐[4‐ fluoro(D4)phenyl]‐1,3‐dihydro‐2‐benzofuran‐5‐ carbonitrile; oxalic acid. |
| Research Area | Labeled Citalopram, intended for use as an internal standard for the quantification of Citalopram by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H19D4FN2O5 |
| CAS# | 59729-33-8 (Unlabeled free base) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(O)=O)=O.CN(C)CCCC1(C2=C([2H])C([2H])=C(F)C([2H])=C2[2H])C3=CC=C(C#N)C=C3CO1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15116.html |
| Additional Information | NULL |