Riboflavin D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03067 |
| Alternative Name(s) | 7,8-bis(²H3)methyl-10-[(2S,3S,4R)-2,3,4,5- tetrahydroxypentyl](6,9-²H2)-2H,3H,4H,10H- benzo[g]pteridine-2,4-dione |
| Research Area | Labeled Riboflavin, intended for use as an internal standard for the quantification of Riboflavin by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 83-88-5 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@H]([C@H](O)[C@H](O)CO)CN1C(C([2H])=C(C([2H])([2H])[2H])C(C([2H])([2H])[2H])=C2[2H])=C2N=C(C(N3)=O)C1=NC3=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03067.html |
| Additional Information | NULL |
