4-Hydroxyphenylglycine D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11071 |
| Alternative Name(s) | [(4-Hydroxyphenyl D4)amino]acetic acid |
| Research Area | Labeled intermediate used in the synthesis of Labeled Amoxycillin |
| Molecular Formula | NULL |
| CAS# | 122-87-2 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CNC1=C([2H])C([2H])=C(O)C([2H])=C1[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11071.html |
| Additional Information | NULL |