Gallic Acid D2
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16650 |
| Alternative Name(s) | 3,4,5-Trihydroxybenzoic-2,6-d2 Acid |
| Research Area | Labeled Gallic Acid, intended for use as an internal standard for the quantification of Gallic Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C7H4D2O5 |
| CAS# | 294660-92-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C1=C(O)C(O)=C(O)C([2H])=C1C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16650.html |
| Additional Information | NULL |