Fenofibrate D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-11268 |
| Alternative Name(s) | Isopropyl 2-(4-lpropanoate |
| Research Area | Labeled Fenofibrate, It is intended for use as an internal standard for the quantification of Fenofibrate by GC- or LC-mass spectrometry. |
| Molecular Formula | C20H17DClO4 |
| CAS# | 1092484-57-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=CC=C(Cl)C=C1)C(C([2H])=C2[2H])=C(C([2H])=C2OC(C)(C)C(OC(C)C)=O)[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11268.html |
| Additional Information | NULL |