Theaflavin-3-3-digallate
Inhibitors
| Trivial name | NULL |
| Catalog Number | CS-O-30726 |
| Alternative Name(s) | (2R,3R)-2-(3,5-dihydroxy-6-oxo-4-((3,4,5-trihydroxybenzoyl)oxy)-8-((3R)-3,5,7-trihydr1-yl)-3,5-dihydr,5-trihydroxybenzoate. |
| Research Area | Theaflavin 3,3'-Digallate has been found to be an inhibitor against human pancreatic a-Amylase. |
| Molecular Formula | C43H32O20 |
| CAS# | 30462-35-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=CC(O)=C(O)C(O)=C1)O[C@H](CC2=C3O)[C@H](OC2=CC(O)=C3)C4=C(C=C([C@@H](OC5=CC(O)=CC(O)=C5C6)[C@@H]6OC(C7=CC(O)=C(O)C(O)=C7)=O)C=C(O)C8=O)C8=C(O)C(O)=C4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30726.html |
| Additional Information | NULL |