N-(2-Ethyl-6-methylphenyl)-N-(2-sulfoacetyl)-L-alanine
NULL
| Trivial name | NULL |
| Catalog Number | CS-T-76017 |
| Alternative Name(s) | (S)-2-(N-(2-Ethyl-6-methylphenyl)-2-sulfoacetamido)propanoic Acid; N-(2-Ethyl-6-methylphenyl)-N-(2-sulfoacetyl)-L-alanine |
| Research Area | N-(2-Ethyl-6-methylphenyl)-N-(2-sulfoacetyl)-L-alanine is a pesticide metabolite that is a pollutant found in in surface water and groundwater. |
| Molecular Formula | C14H19NO6S |
| CAS# | 1418095-19-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H](C(O)=O)N(C1=C(C)C=CC=C1CC)C(CS(=O)(O)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST76017.html |
| Additional Information | NULL |
