Triglycidyl Isocyanurate
NULL
| Trivial name | NULL |
| Catalog Number | CS-T-88052 |
| Alternative Name(s) | 1,3,5-Triglycidyl isocyanurate; 1,3,5-Triglycidyl-s-triazine-2,4,6-trione; 1,3,5-Triglycidylhexahydro-1,3,5-triazine-2,4,6-trione; 1,3,5-Triglycidylisocyanuric acid; 1,3,5-Tris(2,3-epoxypropyl) isocyanurate; 1,3,5- Tris(oxiran-2-ylmethyl)-1,3,5-triazine-2袈袈袈袈 |
| Research Area | Triglycidyl isocyanurate is a reagent used in the synthesis of N-Benzyl Metaxalone, which is a muscle relaxant used to relax muscles and relieve pain. |
| Molecular Formula | C₁₂H₁₅N₃O₆ |
| CAS# | 2451-62-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(CC1CO1)C(N2CC3CO3)=O)N(CC4CO4)C2=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST88052.html |
| Additional Information | NULL |