Pregabalin D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06883 |
| Alternative Name(s) | (3S)-3-(Aminomethyl)-5-methylhexanoic-d4 Acid; (S)-(+)-3-(Aminomethyl)-5-methylhexanoic-d4 Acid; (S)-3-(Ammoniomethyl)-5-methylhexanoate-d4; CI 1008-d4; Lyrica-d4; PD 144723-d4; Pregabalin-d4; |
| Research Area | Isotope labelled S-Enantiomer of Pregabalin. A GABA analogue used as an anticonvulsant. Anxiolytic analgesic used to treat peripheral neuropathic pain and fibromyalgia. |
| Molecular Formula | C₈H₁₃D₄NO₂ |
| CAS# | 1276197-54-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC([2H])([2H])[C@H](C([2H])([2H])C(O)=O)CC(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06883.html |
| Additional Information | NULL |
