Narirutin
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30689 |
| Alternative Name(s) | (2S)-7-[[6-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one; Narirutin; Isonaringenin; Isonaringin; Naringenin 7-O-Rutinoside; Naringenin 7-Rutinoside; Naringenin 7β-Rutinoside |
| Research Area | (2S)-Narirutin is a naturally occurring flavonoid that possess anti-allergic, anti-inflammatory, antiproliferative and anti-oxidant properties. |
| Molecular Formula | C27H32O14 |
| CAS# | 14259-46-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C[C@@H](C1=CC=C(O)C=C1)OC2=CC(O[C@@H]([C@@H]([C@@H](O)[C@@H]3O)O)O[C@@H]3CO[C@H](O[C@@H](C)[C@H](O)[C@H]4O)[C@@H]4O)=C5)C2=C5O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30689.html |
| Additional Information | NULL |