Exemestane 13C D2
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-00728 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Exemestane, intended for use as an internal standard for the quantification of Exemestane by GC- or LC-mass spectrometry. |
| Molecular Formula | C19[13C]H22D2O2 |
| CAS# | 107868-30-4 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C=C1C([C@@]([C@]2([H])[C@](C1)([H])[C@@](CCC3=O)([H])[C@]3(C)CC2)(C=C4)C([2H])([2H])[2H])=CC4=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00728.html |
| Additional Information | NULL |