Efavirenz D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02671 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Efavirenz, intended for use as an internal standard for the quantification of Efavirenz by GC- or LC-mass spectrometry. |
| Molecular Formula | C14H4D5ClF3NO2 |
| CAS# | 1132642-95-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | FC(F)(F)[C@](C1=CC(Cl)=CC=C1NC2=O)(O2)C#CC3([2H])C([2H])([2H])C3([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02671.html |
| Additional Information | NULL |