L-Arginine D7 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06412 |
| Alternative Name(s) | NULL |
| Research Area | Labeled arginine, intended for use as an internal standard for the quantification of arginine by GC- or LC-mass spectrometry. |
| Molecular Formula | C6H8ClD7N4O2 |
| CAS# | 204244-77-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[C@@](C(O)=O)([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])NC(N)=N.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06412.html |
| Additional Information | NULL |