Benzylpenicilloic acid disodium salt, mixture of epimeres
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-16554 |
| Alternative Name(s) | 4-Carboxy-5,5-dimethyl-α-[(2-phenylacetyl)amino]-2-thiazolidineacetic acid disodium salt, Penicilloic acid disodium salt |
| Research Area | Impurity in commercial preparations of Benzylpenicilloic acid. |
| Molecular Formula | C16H18N2Na2O5S |
| CAS# | 13057-98-2 (free acid) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [O-]C(C(C1NC(C([O-])=O)C(C)(C)S1)NC(CC2=CC=CC=C2)=O)=O.[Na+].[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16554.html |
| Additional Information | NULL |