Pitavastatin Lactone D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-13751 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Pitavastatin, intended for use as an internal standard for the quantification of Pitavastatin by GC- or LC-mass spectrometry. |
| Molecular Formula | C25H18D4FNO3 |
| CAS# | 141750-63-2 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C1)C[C@H](OC1=O)/C=C/C2=C(C3=CC=C(F)C=C3)C(C=CC=C4)=C4N=C2C5([2H])C([2H])([2H])C5([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO13751.html |
| Additional Information | NULL |