Thiabendazole
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-05359 |
| Alternative Name(s) | 2-(4-Thiazolyl)-1H-benzimidazole; 4-(2-Benzymidazolyl)thiazole; MK 360; Equizole; Mertect; Mintezol; Tecto; |
| Research Area | A drug used in the treatment of helminthiases. |
| Molecular Formula | C10H7N3S |
| CAS# | 148-79-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C1(C2=CSC=N2)=NC(C=CC=C3)=C3N1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05359.html |
| Additional Information | NULL |