Demeclocycline D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16661 |
| Alternative Name(s) | 6-Demethyl-7-chlortetracycline-D6; Bioterciclin-D6; Demetraclin-D6; Diuciclin-D6; Elkamicina-D6; Ledermycin-D6; Mexocine-D6; Novotriclina-D6; Demethylchlorotetracycline-D6; Perciclina-D6. |
| Research Area | Labeled Demeclocycline, intended for use as an internal standard for the quantification of Demeclocycline by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H15D6ClN2O8 |
| CAS# | 127-33-3(Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@](C(O)=C(C(C1=C2C(Cl)=CC=C1O)=O)[C@]([C@@H]2O)([H])C3)(C(C(C(N)=O)=C4O)=O)[C@]3([H])[C@@H]4N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16661.html |
| Additional Information | NULL |
