Lysergol
Alkaloids
| Trivial name | NULL |
| Catalog Number | CS-T-57340 |
| Alternative Name(s) | (7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinolin-9-yl)methanol |
| Research Area | Lysergol is an ergot alkaloid which when used in combination with antibiotic nalidixic acid, can effectively inhibit Escherichia coli. It also maintains the potential to act on the 5-HT1/2 receptors and at a1-adrenergic receptors thus acting as a neuropsychiatric drug. |
| Molecular Formula | C16H18N2O |
| CAS# | 602-85-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN1[C@@](CC2=CNC3=C2C4=CC=C3)([H])C4=C[C@@H](CO)C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST57340.html |
| Additional Information | NULL |