L-Cystine
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-11015 |
| Alternative Name(s) | 2-amino-3-(((R)-2-amino-2-carboxyethyl)disulfanyl)propanoic acid;CS-O-07117; Acetylcysteine EP Impurity A; L-Cystine |
| Research Area | L-Cystine is a non-essential amino acid for human development. L-Cystine is formed by the dimerization of two cysteines through the sulfur. |
| Molecular Formula | C6H12N2O4S2 |
| CAS# | 56-89-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[C@H](C(O)=O)CSSC[C@H](N)C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11015.html |
| Additional Information | NULL |