Tricyclazole
Agro Chemicals
| Trivial name | NULL |
| Catalog Number | CS-T-43546 |
| Alternative Name(s) | (5-Methyl-1,2,4-triazolo[3,4-b]benzothiazole);5-Methyl-1,2,4-triazolo[3,4-b]benzothiazole |
| Research Area | Tricyclazole is an common active ingredient in several commercial fungicide products used to control rice blast fungus, in transplanted and direct-seeded rice. |
| Molecular Formula | C9H7N3S |
| CAS# | 41814-78-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C=CC=C1S2)=C1N3C2=NN=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST43546.html |
| Additional Information | NULL |