Medroxyprogesterone acetate
Marine
| Trivial name | NULL |
| Catalog Number | CS-O-01829 |
| Alternative Name(s) | (1S,2R,8S,10R,11S,14R,15S)-.0¹¹,¹5]heptadc-6-en-14-yl cetate;Megestrol cetate Impurity F. |
| Research Area | Medroxyprogesterone acetate is a synthetic progestin that is derived from 17-hydroxyprogesterone. It is a long-acting contraceptive that is effective both orally or by intramuscular injection and has also been used to treat breast and endometrial neoplasm |
| Molecular Formula | C24H34O4 |
| CAS# | 71-58-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(O[C@@]([C@]12C)(CC[C@@]1([H])[C@@](C[C@H](C)C3=CC4=O)([H])[C@]([C@]3(CC4)C)([H])CC2)C(C)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01829.html |
| Additional Information | NULL |