Caffeine
Marine
| Trivial name | NULL |
| Catalog Number | CS-O-00486 |
| Alternative Name(s) | 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione |
| Research Area | Caffeine is a bitter, white crystalline xanthine alkaloid that acts as a stimulant drug and a reversible acetylcholinesterase inhibitor. Caffeine is found in varying quantities in the seeds, leaves, and fruit of some plants, where it acts as a natural pes |
| Molecular Formula | C8H10N4O2 |
| CAS# | 58-08-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N1C)C(N2C)=C(N=C2)N(C)C1=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00486.html |
| Additional Information | NULL |