L-Arabinose
Carbohydrates
| Trivial name | NULL |
| Catalog Number | CS-T-04078 |
| Alternative Name(s) | L-Arabinopyranose |
| Research Area | A base component of hemicellulose and pectin, critical biopolymers. |
| Molecular Formula | NULL |
| CAS# | 87-72-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H]([C@H](CO1)O)[C@H](C1O)O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST04078.html |
| Additional Information | NULL |
