Nalidixic acid D5
Marine
| Trivial name | NULL |
| Catalog Number | CS-W-00211 |
| Alternative Name(s) | 1-[(1,1,2,2,2-2H5)ethyl]-7-methyl-4-oxo-1,4- dihydro-1,8-naphthyridine-3-carboxylic acid |
| Research Area | Labeled Nalidixic acid, intended for use as an internal standard for the quantification of Nalidixic acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C12H7D5N2O3 |
| CAS# | 1189467-36-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=CC=C(C)N=C2N(C=C1C(O)=O)C([2H])([2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00211.html |
| Additional Information | NULL |