Glycyl-histidyl-lysine, monocopper salt
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-11113 |
| Alternative Name(s) | monocopper(II) mono((S)-6-amino-2-((S)-2-(2-aminoacetamido)-3-(1H-imidazol-4-yl)propanamido)hexanoate) |
| Research Area | [N2-(N-Glycyl-L-histidyl)-L-lysinato(2-)]copper Dihydrate is a tripeptide found in plasma. It increases fibroblast proliferation and is widely used in wound healing creams. Also induces cell death in SH-SY5Y neuroblastoma cells. |
| Molecular Formula | NULL |
| CAS# | 89030-95-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C([C@H]1[N-](C2=O)[Cu+2]([NH2]C2)[N]3=CNC=C3C1)N[C@H](C([O-])=O)CCCCN |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11113.html |
| Additional Information | NULL |