L-Ornithine -L-Aspartate
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-30966 |
| Alternative Name(s) | (S)-2,5-diaminopentanoic acid compound with (S)-2-aminosuccinic acid (1:1) |
| Research Area | NULL |
| Molecular Formula | C9H19N3O6 |
| CAS# | 3230-94-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | N[C@H](C(O)=O)CC(O)=O.N[C@@H](CCCN)C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30966.html |
| Additional Information | NULL |