L-carnitine
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-01777 |
| Alternative Name(s) | L-carnitine;(2R)-1-propanaminium Inner Salt; |
| Research Area | Essential cofactor of fatty acid metabolism; required for the transport of fatty acids through the inner mitochondrial membrane. Synthetized primarily in the liver and kidney; highest concentrations found in heart and skeletal muscle. Dietary sources incl |
| Molecular Formula | C7H15NO3 |
| CAS# | 541-15-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[N+](C)(C)C[C@H](O)CC([O-])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01777.html |
| Additional Information | NULL |