Ascomycin
Peptides
| Trivial name | NULL |
| Catalog Number | CS-O-00842 |
| Alternative Name(s) | ChFR 520; FR 900520; L 683590ated Compound A ; CS-P-00143 |
| Research Area | A potent immunosuppressive agent and could be used as a potential therapeutic agent for autoimmune diseases. |
| Molecular Formula | C43H69NO12 |
| CAS# | 104987-12-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CO[C@@H]1[C@]([C@H](C[C@H](C/C(C)=C[C@H](C(C[C@H](O)[C@H]2C)=O)CC)C)OC)([H])O[C@@](O)(C(C(N(CCCC3)[C@]3([H])C(O[C@@H]2/C(C)=C/[C@H](CC[C@H]4O)C[C@H]4OC)=O)=O)=O)[C@H](C)C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00842.html |
| Additional Information | NULL |