Metronidazole D4
Marine
| Trivial name | NULL |
| Catalog Number | CS-O-02663 |
| Alternative Name(s) | 2-Methyl-5-nitro-1H-imidazole-1-(ethanol-d4) |
| Research Area | Labelled Metronidazole . Used as an antibacterial in the treatment of rosacea. Antiprotozoal (trichomonas). A potential human carcinogen.;Labeled Ronidazole, intended for use as an internal standard for the quantification of Ronidazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C6H5D4N3O3 |
| CAS# | 1261392-47-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([2H])([2H])C([2H])([2H])N1C([N](=O)=O)=CN=C1C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02663.html |
| Additional Information | NULL |