Gypsogenic Acid
Phytochemicals
| Trivial name | NULL |
| Catalog Number | CS-T-55487 |
| Alternative Name(s) | (3b,4a)-3-Hydroxy-olean-12-ene-23,28-d3,28-dagenin J; Gypsogeninic Acid;(3β,4α)-3-Hydroxy-olean-12-ene-23,28-dioic Acid. |
| Research Area | Gypsogenic Acid, a triterpenoid saponin of the Caryophyllaceae family, is shown to be a promising antiplaque and anticaries agent. |
| Molecular Formula | C30H46O5 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1(CC[C@]2(C(O)=O)[C@@]3([H])CC(C)(C)CC2)C3=CC[C@@]4([H])[C@]1(CC[C@]5([H])[C@@]4(CC[C@H](O)[C@@]5(C)C(O)=O)C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST55487.html |
| Additional Information | NULL |
