Tris(dibenzylideneacetone) dipalladium
Catalysts
| Trivial name | NULL |
| Catalog Number | CS-O-10493 |
| Alternative Name(s) | (all-E)-Tris[µ-[(1,2-?:4,5-?)-1,5-diphenyl-1,4-pentadien-3-one]]di-palladium; (E,E)-1,5-Diphenyl-1,4-pentadien-3-one Palladium Complex;Tris(dibenzylideneacetonyl)bis-palladium; Tris[(1E,4E)-1,5-diphenyl-1,4-pentadien-3-one]dipalladium; |
| Research Area | Tris(dibenzylideneacetone)dipalladium is used in the preparation of semiconducting polymers processed from nonchlorinated solvents into high performance thin film transistors. Also used in the synthesis of polymer bulk-heterojunction solar sells a |
| Molecular Formula | C17H14O |
| CAS# | 51364-51-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C([CH]1=[CH](C2=CC=CC=C2)[Pd]134([CH]5=[CH]4C6=CC=CC=C6)[CH]7=[CH]3C8=CC=CC=C8)[CH]9=[CH](C%10=CC=CC=C%10)[Pd]9%11%12([CH](C5=O)=[CH]%12C%13=CC=CC=C%13)[CH](C7=O)=[CH]%11C%14=CC=CC=C%14 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10493.html |
| Additional Information | NULL |