D -(-)-Tartaric acid diisopropyl ester
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-U-00146 |
| Alternative Name(s) | (2R,3S)-diisopropyl 2,3-dihydroxysuccinate |
| Research Area | D-(-)-Diisopropyl Tartrate is a reagent for kinetic resolution of racemic allylic alcohols and α-furfuryl amides by enantioselective epoxidation. |
| Molecular Formula | C10H18O6 |
| CAS# | 62961-64-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C)OC(=O)C(C(C(=O)OC(C)C)O)O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSU00146.html |
| Additional Information | NULL |