Phenolphthalein
Inhibitors
| Trivial name | NULL |
| Catalog Number | CS-O-11712 |
| Alternative Name(s) | 3,3-Bis(4-hydroxyphenyl)-1(3H)-isobenzofuranone; 3,3-Bis(4-hydroxyphenyl)phthalide; 3,3-Bis(p-hydroxyphenyl)phthalide |
| Research Area | Phenolphthalein can be used as an inhibitor and pH indicator. It also induces centrosome amplification and tubulin depolymerization in vitro. |
| Molecular Formula | C20H14O4 |
| CAS# | 77-09-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1OC(C2=CC=C(O)C=C2)(C3=CC=C(O)C=C3)C4=C1C=CC=C4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11712.html |
| Additional Information | NULL |