Oleic Acid
Fatty Acid Derivatives
| Trivial name | NULL |
| Catalog Number | CS-T-37953 |
| Alternative Name(s) | Elainic acid; |
| Research Area | Oleic acid is a monounsaturated omega-9 fatty acid. Oleic Acid is obtained by the hydrolysis of various animal and vegetable fats and oils. Oleic Acid is used as an emulsifying or solubilizing agent in aerosol products. |
| Molecular Formula | C18H34O2 |
| CAS# | 112-80-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CCCCCCC/C=CCCCCCCCC)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST37953.html |
| Additional Information | NULL |