Methyltrioctylammonium Chloride
Catalysts
| Trivial name | NULL |
| Catalog Number | CS-T-35341 |
| Alternative Name(s) | N-methyl-N,N-dioctyloctan-1-aminium chloride |
| Research Area | Methyltrioctylammonium chloride is a tetraalkylammonium salt that acts as a cationic surfactant. Methyltrioctylammonium chloride is also used as a phase transfer catalyst in the epoxidation of 1,4-diallyloxybutane to 1-allyloxy-4-glycidyloxybutane. |
| Molecular Formula | C25H54N•Cl |
| CAS# | 5137-55-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.[Cl-] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST35341.html |
| Additional Information | NULL |