Ellagic Acid
Phytochemicals
| Trivial name | NULL |
| Catalog Number | CS-T-54027 |
| Alternative Name(s) | Alizarin yellow; Alizarine Yellow; Benzolagostasine; Ele Gallogen; Gallogen (astringent); LDN 0097519; Lagistase; |
| Research Area | Ellagic Acid is a phenol antioxidant found naturally in various fruits and vegetables. Ellagic Acid was shown to exhibit high levels of antiproliferative and antioxidant properties in studies, which suggests its potential health benefits following ellagic acid consumption. |
| Molecular Formula | C14H6O8 |
| CAS# | 476-66-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(O1)=C2C(C(O3)=C4O)=C(C=C4O)C1=O)=C(C=C2C3=O)O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST54027.html |
| Additional Information | NULL |