4-Hydroxybenzaldehyde D4
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-15383 |
| Alternative Name(s) | 4-Hydroxybenzaldehyde-2,3,5,6-d4; 4-Hydroxybenzaldehyde-d4; |
| Research Area | 4-Hydroxybenzaldehyde-d4 is the isotope labelled analog of 4-Hydroxybenzaldehyde; a compound that maintains bactericidal activity when tested against certain bacteria strains. It also displays antioxidant potential when analyzed through assay. |
| Molecular Formula | C7H2D4O2 |
| CAS# | 284474-52-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=CC(C([2H])=C1[2H])=C(C([2H])=C1O)[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15383.html |
| Additional Information | NULL |