Leucomalachite green D6
Marine
| Trivial name | NULL |
| Catalog Number | CS-W-00093 |
| Alternative Name(s) | 4‐{[4‐(dimethylamino)phenyl](D5)phenyl(D)methyl}‐ N,N‐dimethylaniline |
| Research Area | Labeled Leucomalachite, intended for use as an internal standard for the quantification of Leucomalachite by GC- or LC-mass spectrometry. |
| Molecular Formula | C23H20D6N2 |
| CAS# | 1173021-13-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(C)C1=CC=C(C=C1)C(C(C([2H])=C2[2H])=C(C([2H])=C2[2H])[2H])([2H])C3=CC=C(N(C)C)C=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00093.html |
| Additional Information | NULL |