Isoproturon
Pesticides
| Trivial name | NULL |
| Catalog Number | CS-T-30049 |
| Alternative Name(s) | N,N-Dimethyl-N'-[4-(1-methylethyl)phenyl]urea |
| Research Area | Pre-and post-emergence herbicide for control of annual grasses and broad-leaved weeds. Herbicide. |
| Molecular Formula | C12H18N2O |
| CAS# | 34123-59-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(c1ccc(NC(N(C)C)=O)cc1)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST30049.html |
| Additional Information | NULL |