Benzaldehyde D6
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-14865 |
| Alternative Name(s) | (D5)phenyl(D)formaldehyde;Benzaldehyde-D6; Benzaldehyde-d6. |
| Research Area | Labeled Benzaldehyde , intended for use as an internal standard for the quantification of Benzaldehyde by GC- or LC-mass spectrometry. |
| Molecular Formula | C7D6O |
| CAS# | 17901-93-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14865.html |
| Additional Information | NULL |