Hederacoside C
Phytochemicals
| Trivial name | NULL |
| Catalog Number | CS-O-30597 |
| Alternative Name(s) | Hederasaponin C;Clematangoside A;Olean-12-en-28-oic acid |
| Research Area | Hederacoside C is a Hedera helix leaf which has been used in botanical drug formulations to treat acute respiratory infection and bronchitis. Anti-myocardial. |
| Molecular Formula | C59H96O26 |
| CAS# | 14216-03-06 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1C(O)C(O)C(O)C(OC2C(CO)OC(OCC3C(O)C(O)C(O)C(OC(C45CCC(C)(C)CC4C6=CCC7C8(C)CCC(OC9C(OC%10C(O)C(O)C(O)C(C)O%10)C(O)C(O)CO9)C(C)(CO)C8CCC7(C)C6(C)CC5)=O)O3)C(O)C2O)O1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30597.html |
| Additional Information | NULL |