Malachite Green
Dyes
| Trivial name | NULL |
| Catalog Number | CS-T-31437 |
| Alternative Name(s) | N-[4-[[4-(Dimethylamino)phenyl]phenylmethylene]-2methanaminium |
| Research Area | A triphenylmethane dye with fungicidal and limited antiseptic activity. The term Malachine green applies to the oxalate as well as the chloride. Harmful if swallowed. Avoid release to the environment. |
| Molecular Formula | C23H25ClN2 |
| CAS# | 569-64-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN(C)C1=CC=C(C=C1)/C(C2=CC=CC=C2)=C(C=C/3)C=CC3=[N+](C)C.[Cl-] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST31437.html |
| Additional Information | NULL |