Phenol D5
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-T-60354 |
| Alternative Name(s) | Benzenol-d5; Hydroxybenzene-d5; |
| Research Area | Phenol is purified here for molecular genetics applications. It is naturally found in tea leaves and plants, and has uses in the synthesis of antioxidant compounds due to the antioxidant activity caused by the phenol moiety. This structure also allows it to be used for syntheses of anti-bacterial & anti-carcinogenic compounds. This is the labelled analog. |
| Molecular Formula | C6HD5O |
| CAS# | 4165-62-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST60354.html |
| Additional Information | NULL |