Aspirin D4
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-02745 |
| Alternative Name(s) | 2-acetoxy benzoic acid D4; Acetylsalicylic Acid-d4;CS-BU-00022 |
| Research Area | Labeled Aspirin, intended for use as an internal standard for the quantification of Aspirin by GC- or LC-mass spectrometry. |
| Molecular Formula | C9H4O4D4 |
| CAS# | 97781-16-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(C([2H])=C1[2H])=C(C([2H])=C1[2H])OC(C)=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02745.html |
| Additional Information | NULL |