Acetophenone D5
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-02954 |
| Alternative Name(s) | Phenylethanone-d5; 1-Feniletanone-d5; 1-(Phenyl-d5)-1-ethanone; 1-(Phenyl-d5)ethanone; cetophenon-d5; cetylbenzene-d5; Hypnon-d5; Hypnone-d5; Methyl (Phenyl-d5) Ketone; Nc 7635-d5; Nc 98542-d5; (Phenyl-d5) Methyl Ketone; |
| Research Area | Labeled Acetophenone, intended for use as an internal standard for the quantification of Acetophenoneby GC- or LC-mass spectrometry. |
| Molecular Formula | C8H3D5O |
| CAS# | 28077-64-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02954.html |
| Additional Information | NULL |