Adamantane D16
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-06379 |
| Alternative Name(s) | (D16)adamantane;Trcclo[3.3.1.13,7]dcane-1,2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-d16; Trcclo[3.3.1.13,7]dcane-d16; Perdeuteroadamantane; |
| Research Area | Labeled Adamantane, intended for use as an internal standard for the quantification of Adamantane by GC- or LC-mass spectrometry. |
| Molecular Formula | C10D16 |
| CAS# | 30470-60-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C1(C([2H])([2H])C(C2([2H])[2H])([2H])C3([2H])[2H])C([2H])([2H])C3([2H])C([2H])([2H])C2([2H])C1([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06379.html |
| Additional Information | NULL |
