Acetyl-l-carnitine
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-30532 |
| Alternative Name(s) | 3-acetoxy-4-(trimethylammonio)butanoate |
| Research Area | Acetyl-L-carnitine is an acetic acid ester of CARNITINE that facilitates movement of ACETYL COA into the matrices of mammalian MITOCHONDRIA during the oxidation of FATTY ACIDS. |
| Molecular Formula | C9H17NO4 |
| CAS# | 3040-38-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[N+](C)(C)C[C@H](OC(C)=O)CC([O-])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30532.html |
| Additional Information | NULL |