Eicosapentaenoic Acid
Fatty Acid Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-06152 |
| Alternative Name(s) | Icosapent;Incromega E 7010SR;(5Z,8Z,11Z,14Z,17Z)-5,8,11,14,1711,14,17cid;(5Z,8Z,11Z,14Z,17Z)-5,8,11,14,1711,14,17cid; EPA; EPA 45G; Icosapent; Icosapentaenoic Acid; Incromega E 7010SR; Ropufa 70; Timnodonic Acid; CS-EE-00074 |
| Research Area | Important polyunsaturated fatty acid of the marine food chain that serves as a precursor for the prostaglandin-3 and thromboxane-3 families. It differs from arachidonic acid (the eicosatetraenoic acid that is a precursor for the prostaglandin and thrombox |
| Molecular Formula | C20H30O2 |
| CAS# | 10417-94-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CCC/C=CC/C=CC/C=CC/C=CC/C=CCC)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06152.html |
| Additional Information | NULL |
